C12H13N — CID 172623300
2-methyl-1,6,7,8-tetrahydrocyclopenta[g]indole (PubChem CID 172623300) has the molecular formula C12H13N and a molecular weight of 171.24 g/mol. Its IUPAC name is 2-methyl-1,6,7,8-tetrahydrocyclopenta[g]indole.
| Compound Name | 2-methyl-1,6,7,8-tetrahydrocyclopenta[g]indole |
|---|---|
| PubChem CID | 172623300 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 2-methyl-1,6,7,8-tetrahydrocyclopenta[g]indole |
| SMILES | Cc1cc2ccc3c(c2[nH]1)CCC3 |
| InChI | InChI=1S/C12H13N/c1-8-7-10-6-5-9-3-2-4-11(9)12(10)13-8/h5-7,13H,2-4H2,1H3 |
| InChIKey | IQOTZEICOZZUHZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |