C16H20N2O — CID 172623322
2,5-diethyl-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carbaldehyde (PubChem CID 172623322) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 2,5-diethyl-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carbaldehyde.
| Compound Name | 2,5-diethyl-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carbaldehyde |
|---|---|
| PubChem CID | 172623322 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 2,5-diethyl-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carbaldehyde |
| SMILES | CCN1CCc2c(c3cc(C=O)ccc3n2CC)C1 |
| InChI | InChI=1S/C16H20N2O/c1-3-17-8-7-16-14(10-17)13-9-12(11-19)5-6-15(13)18(16)4-2/h5-6,9,11H,3-4,7-8,10H2,1-2H3 |
| InChIKey | FOQVWZBBNNJZKC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|