C37H47N9 — CID 172623377
(2E)-1-N,1-N-dimethyl-4-N-[1-[[2-[1-[4-(4-piperidin-1-yl-7H-pyrrolo[2,3-d]pyrimidin-6-yl)anilino]ethenyl]-4-pyridinyl]methyl]piperidin-3-yl]penta-2,4-diene-1,4-diamine (PubChem CID 172623377) has the molecular formula C37H47N9 and a molecular weight of 617.85 g/mol. Its IUPAC name is (2E)-1-N,1-N-dimethyl-4-N-[1-[[2-[1-[4-(4-piperidin-1-yl-7H-pyrrolo[2,3-d]pyrimidin-6-yl)anilino]ethenyl]-4-pyridinyl]methyl]piperidin-3-yl]penta-2,4-diene-1,4-diamine.
| Compound Name | (2E)-1-N,1-N-dimethyl-4-N-[1-[[2-[1-[4-(4-piperidin-1-yl-7H-pyrrolo[2,3-d]pyrimidin-6-yl)anilino]ethenyl]-4-pyridinyl]methyl]piperidin-3-yl]penta-2,4-diene-1,4-diamine |
|---|---|
| PubChem CID | 172623377 |
| Molecular Formula | C37H47N9 |
| Molecular Weight | 617.85 g/mol |
| Exact Mass | 617.40 |
| IUPAC Name | (2E)-1-N,1-N-dimethyl-4-N-[1-[[2-[1-[4-(4-piperidin-1-yl-7H-pyrrolo[2,3-d]pyrimidin-6-yl)anilino]ethenyl]-4-pyridinyl]methyl]piperidin-3-yl]penta-2,4-diene-1,4-diamine |
| SMILES | C=C(/C=C/CN(C)C)NC1CCCN(Cc2ccnc(C(=C)Nc3ccc(-c4cc5c(N6CCCCC6)ncnc5[nH]4)cc3)c2)C1 |
| InChI | InChI=1S/C37H47N9/c1-27(10-8-18-44(3)4)41-32-11-9-19-45(25-32)24-29-16-17-38-34(22-29)28(2)42-31-14-12-30(13-15-31)35-23-33-36(43-35)39-26-40-37(33)46-20-6-5-7-21-46/h8,10,12-17,22-23,26,32,41-42H,1-2,5-7,9,11,18-21,24-25H2,3-4H3,(H,39,40,43)/b10-8+ |
| InChIKey | UJQSVPIMEIORJJ-CSKARUKUSA-N |
| XLogP | 6.28 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.85 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|