C29H41F3N6O2Si — CID 172623522
4-[4-morpholin-4-yl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-6-yl]-N-(2,2,2-trifluoro-1-piperidin-4-ylethyl)aniline (PubChem CID 172623522) has the molecular formula C29H41F3N6O2Si and a molecular weight of 590.77 g/mol. Its IUPAC name is 4-[4-morpholin-4-yl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-6-yl]-N-(2,2,2-trifluoro-1-piperidin-4-ylethyl)aniline.
| Compound Name | 4-[4-morpholin-4-yl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-6-yl]-N-(2,2,2-trifluoro-1-piperidin-4-ylethyl)aniline |
|---|---|
| PubChem CID | 172623522 |
| Molecular Formula | C29H41F3N6O2Si |
| Molecular Weight | 590.77 g/mol |
| Exact Mass | 590.30 |
| IUPAC Name | 4-[4-morpholin-4-yl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-6-yl]-N-(2,2,2-trifluoro-1-piperidin-4-ylethyl)aniline |
| SMILES | C[Si](C)(C)CCOCn1c(-c2ccc(NC(C3CCNCC3)C(F)(F)F)cc2)cc2c(N3CCOCC3)ncnc21 |
| InChI | InChI=1S/C29H41F3N6O2Si/c1-41(2,3)17-16-40-20-38-25(18-24-27(34-19-35-28(24)38)37-12-14-39-15-13-37)21-4-6-23(7-5-21)36-26(29(30,31)32)22-8-10-33-11-9-22/h4-7,18-19,22,26,33,36H,8-17,20H2,1-3H3 |
| InChIKey | NIHBGUKTHYKCJT-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.77 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|