C28H30N8O2 — CID 172623708
1-[4-[5-[4-(4-morpholin-4-yl-7H-pyrrolo[2,3-d]pyrimidin-6-yl)anilino]-2-pyridinyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 172623708) has the molecular formula C28H30N8O2 and a molecular weight of 510.60 g/mol. Its IUPAC name is 1-[4-[5-[4-(4-morpholin-4-yl-7H-pyrrolo[2,3-d]pyrimidin-6-yl)anilino]-2-pyridinyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[5-[4-(4-morpholin-4-yl-7H-pyrrolo[2,3-d]pyrimidin-6-yl)anilino]-2-pyridinyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 172623708 |
| Molecular Formula | C28H30N8O2 |
| Molecular Weight | 510.60 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | 1-[4-[5-[4-(4-morpholin-4-yl-7H-pyrrolo[2,3-d]pyrimidin-6-yl)anilino]-2-pyridinyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2ccc(Nc3ccc(-c4cc5c(N6CCOCC6)ncnc5[nH]4)cc3)cn2)CC1 |
| InChI | InChI=1S/C28H30N8O2/c1-2-26(37)35-11-9-34(10-12-35)25-8-7-22(18-29-25)32-21-5-3-20(4-6-21)24-17-23-27(33-24)30-19-31-28(23)36-13-15-38-16-14-36/h2-8,17-19,32H,1,9-16H2,(H,30,31,33) |
| InChIKey | URYUVTXNYUNOMM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.60 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|