About N-[1-(azetidin-3-yl)-2,2,2-trifluoroethyl]-2-methylpropane-2-sulfinamide
N-[1-(azetidin-3-yl)-2,2,2-trifluoroethyl]-2-methylpropane-2-sulfinamide (PubChem CID 172624090) has the molecular formula C9H17F3N2OS
and a molecular weight of 258.31 g/mol. Its IUPAC name is N-[1-(azetidin-3-yl)-2,2,2-trifluoroethyl]-2-methylpropane-2-sulfinamide.
Molecular Properties
| Compound Name | N-[1-(azetidin-3-yl)-2,2,2-trifluoroethyl]-2-methylpropane-2-sulfinamide |
| PubChem CID | 172624090 |
| Molecular Formula | C9H17F3N2OS |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | N-[1-(azetidin-3-yl)-2,2,2-trifluoroethyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)NC(C1CNC1)C(F)(F)F |
| InChI | InChI=1S/C9H17F3N2OS/c1-8(2,3)16(15)14-7(9(10,11)12)6-4-13-5-6/h6-7,13-14H,4-5H2,1-3H3 |
| InChIKey | JSKMJKVTFHUNEP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[1-(azetidin-3-yl)-2,2,2-trifluoroethyl]-2-methylpropane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(azetidin-3-yl)-2,2,2-trifluoroethyl]-2-methylpropane-2-sulfinamide?
The IUPAC name of N-[1-(azetidin-3-yl)-2,2,2-trifluoroethyl]-2-methylpropane-2-sulfinamide (CID 172624090) is N-[1-(azetidin-3-yl)-2,2,2-trifluoroethyl]-2-methylpropane-2-sulfinamide.
What is the SMILES notation for N-[1-(azetidin-3-yl)-2,2,2-trifluoroethyl]-2-methylpropane-2-sulfinamide?
The canonical SMILES for N-[1-(azetidin-3-yl)-2,2,2-trifluoroethyl]-2-methylpropane-2-sulfinamide is CC(C)(C)S(=O)NC(C1CNC1)C(F)(F)F.
What is the InChIKey of N-[1-(azetidin-3-yl)-2,2,2-trifluoroethyl]-2-methylpropane-2-sulfinamide?
The InChIKey is JSKMJKVTFHUNEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F3N2OS/c1-8(2,3)16(15)14-7(9(10,11)12)6-4-13-5-6/h6-7,13-14H,4-5H2,1-3H3.
What are the key properties of N-[1-(azetidin-3-yl)-2,2,2-trifluoroethyl]-2-methylpropane-2-sulfinamide?
N-[1-(azetidin-3-yl)-2,2,2-trifluoroethyl]-2-methylpropane-2-sulfinamide has a molecular weight of 258.31 g/mol, XLogP of 1.19, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(azetidin-3-yl)-2,2,2-trifluoroethyl]-2-methylpropane-2-sulfinamide is sourced from PubChem (CID 172624090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).