C11H10BrF2NO2 — CID 172624646
(4-bromo-2-fluorophenyl) 3-fluoropyrrolidine-1-carboxylate (PubChem CID 172624646) has the molecular formula C11H10BrF2NO2 and a molecular weight of 306.11 g/mol. Its IUPAC name is (4-bromo-2-fluorophenyl) 3-fluoropyrrolidine-1-carboxylate.
| Compound Name | (4-bromo-2-fluorophenyl) 3-fluoropyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 172624646 |
| Molecular Formula | C11H10BrF2NO2 |
| Molecular Weight | 306.11 g/mol |
| Exact Mass | 304.99 |
| IUPAC Name | (4-bromo-2-fluorophenyl) 3-fluoropyrrolidine-1-carboxylate |
| SMILES | O=C(Oc1ccc(Br)cc1F)N1CCC(F)C1 |
| InChI | InChI=1S/C11H10BrF2NO2/c12-7-1-2-10(9(14)5-7)17-11(16)15-4-3-8(13)6-15/h1-2,5,8H,3-4,6H2 |
| InChIKey | UFKNBXDSRWMUDV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.11 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |