C13H21F3N3NiO3+ — CID 172626091
nickel(2+);2-[4-(6,6,6-trifluorohexylcarbamoyl)piperazin-1-yl]acetic acid (PubChem CID 172626091) has the molecular formula C13H21F3N3NiO3+ and a molecular weight of 383.02 g/mol. Its IUPAC name is nickel(2+);2-[4-(6,6,6-trifluorohexylcarbamoyl)piperazin-1-yl]acetic acid.
| Compound Name | nickel(2+);2-[4-(6,6,6-trifluorohexylcarbamoyl)piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 172626091 |
| Molecular Formula | C13H21F3N3NiO3+ |
| Molecular Weight | 383.02 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | nickel(2+);2-[4-(6,6,6-trifluorohexylcarbamoyl)piperazin-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(C(=O)NCCCC[CH-]C(F)(F)F)CC1.[Ni+2] |
| InChI | InChI=1S/C13H21F3N3O3.Ni/c14-13(15,16)4-2-1-3-5-17-12(22)19-8-6-18(7-9-19)10-11(20)21;/h4H,1-3,5-10H2,(H,17,22)(H,20,21);/q-1;+2 |
| InChIKey | ZMGMBIXDCJLQGR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.02 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|