About acetylene;ethane;methyl N-[2-oxo-2-[(3R)-3-(trifluoromethyl)pyrrolidin-1-yl]ethyl]carbamate
acetylene;ethane;methyl N-[2-oxo-2-[(3R)-3-(trifluoromethyl)pyrrolidin-1-yl]ethyl]carbamate (PubChem CID 172626146) has the molecular formula C13H21F3N2O3
and a molecular weight of 310.32 g/mol. Its IUPAC name is acetylene;ethane;methyl N-[2-oxo-2-[(3R)-3-(trifluoromethyl)pyrrolidin-1-yl]ethyl]carbamate.
Molecular Properties
| Compound Name | acetylene;ethane;methyl N-[2-oxo-2-[(3R)-3-(trifluoromethyl)pyrrolidin-1-yl]ethyl]carbamate |
| PubChem CID | 172626146 |
| Molecular Formula | C13H21F3N2O3 |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | acetylene;ethane;methyl N-[2-oxo-2-[(3R)-3-(trifluoromethyl)pyrrolidin-1-yl]ethyl]carbamate |
| SMILES | C#C.CC.COC(=O)NCC(=O)N1CC[C@@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C9H13F3N2O3.C2H6.C2H2/c1-17-8(16)13-4-7(15)14-3-2-6(5-14)9(10,11)12;2*1-2/h6H,2-5H2,1H3,(H,13,16);1-2H3;1-2H/t6-;;/m1../s1 |
| InChIKey | MFMDVVWTQZOLFZ-QYCVXMPOSA-N |
| XLogP | 2.03 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;ethane;methyl N-[2-oxo-2-[(3R)-3-(trifluoromethyl)pyrrolidin-1-yl]ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;ethane;methyl N-[2-oxo-2-[(3R)-3-(trifluoromethyl)pyrrolidin-1-yl]ethyl]carbamate?
The IUPAC name of acetylene;ethane;methyl N-[2-oxo-2-[(3R)-3-(trifluoromethyl)pyrrolidin-1-yl]ethyl]carbamate (CID 172626146) is acetylene;ethane;methyl N-[2-oxo-2-[(3R)-3-(trifluoromethyl)pyrrolidin-1-yl]ethyl]carbamate.
What is the SMILES notation for acetylene;ethane;methyl N-[2-oxo-2-[(3R)-3-(trifluoromethyl)pyrrolidin-1-yl]ethyl]carbamate?
The canonical SMILES for acetylene;ethane;methyl N-[2-oxo-2-[(3R)-3-(trifluoromethyl)pyrrolidin-1-yl]ethyl]carbamate is C#C.CC.COC(=O)NCC(=O)N1CC[C@@H](C(F)(F)F)C1.
What is the InChIKey of acetylene;ethane;methyl N-[2-oxo-2-[(3R)-3-(trifluoromethyl)pyrrolidin-1-yl]ethyl]carbamate?
The InChIKey is MFMDVVWTQZOLFZ-QYCVXMPOSA-N. The full InChI is InChI=1S/C9H13F3N2O3.C2H6.C2H2/c1-17-8(16)13-4-7(15)14-3-2-6(5-14)9(10,11)12;2*1-2/h6H,2-5H2,1H3,(H,13,16);1-2H3;1-2H/t6-;;/m1../s1.
What are the key properties of acetylene;ethane;methyl N-[2-oxo-2-[(3R)-3-(trifluoromethyl)pyrrolidin-1-yl]ethyl]carbamate?
acetylene;ethane;methyl N-[2-oxo-2-[(3R)-3-(trifluoromethyl)pyrrolidin-1-yl]ethyl]carbamate has a molecular weight of 310.32 g/mol, XLogP of 2.03, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;ethane;methyl N-[2-oxo-2-[(3R)-3-(trifluoromethyl)pyrrolidin-1-yl]ethyl]carbamate is sourced from PubChem (CID 172626146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).