C28H32FN7O5 — CID 172626470
6-[[6-(2-fluoro-6-methoxyphenyl)-5-nitro-2-pyridinyl]amino]-4-[(3S)-3-hydroxypiperidin-1-yl]-N-[(3R)-1-methylpyrrolidin-3-yl]pyridine-3-carboxamide (PubChem CID 172626470) has the molecular formula C28H32FN7O5 and a molecular weight of 565.61 g/mol. Its IUPAC name is 6-[[6-(2-fluoro-6-methoxyphenyl)-5-nitro-2-pyridinyl]amino]-4-[(3S)-3-hydroxypiperidin-1-yl]-N-[(3R)-1-methylpyrrolidin-3-yl]pyridine-3-carboxamide.
| Compound Name | 6-[[6-(2-fluoro-6-methoxyphenyl)-5-nitro-2-pyridinyl]amino]-4-[(3S)-3-hydroxypiperidin-1-yl]-N-[(3R)-1-methylpyrrolidin-3-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 172626470 |
| Molecular Formula | C28H32FN7O5 |
| Molecular Weight | 565.61 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | 6-[[6-(2-fluoro-6-methoxyphenyl)-5-nitro-2-pyridinyl]amino]-4-[(3S)-3-hydroxypiperidin-1-yl]-N-[(3R)-1-methylpyrrolidin-3-yl]pyridine-3-carboxamide |
| SMILES | COc1cccc(F)c1-c1nc(Nc2cc(N3CCC[C@H](O)C3)c(C(=O)N[C@@H]3CCN(C)C3)cn2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H32FN7O5/c1-34-12-10-17(15-34)31-28(38)19-14-30-25(13-22(19)35-11-4-5-18(37)16-35)32-24-9-8-21(36(39)40)27(33-24)26-20(29)6-3-7-23(26)41-2/h3,6-9,13-14,17-18,37H,4-5,10-12,15-16H2,1-2H3,(H,31,38)(H,30,32,33)/t17-,18+/m1/s1 |
| InChIKey | XAOWSMMPJFKPLL-MSOLQXFVSA-N |
| XLogP | 3.34 |
| TPSA | 145.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.61 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|