About 3,6-bis(4-tert-butylphenyl)-3-methyl-4,9-dihydrocarbazole
3,6-bis(4-tert-butylphenyl)-3-methyl-4,9-dihydrocarbazole (PubChem CID 172627203) has the molecular formula C33H37N
and a molecular weight of 447.67 g/mol. Its IUPAC name is 3,6-bis(4-tert-butylphenyl)-3-methyl-4,9-dihydrocarbazole.
Molecular Properties
| Compound Name | 3,6-bis(4-tert-butylphenyl)-3-methyl-4,9-dihydrocarbazole |
| PubChem CID | 172627203 |
| Molecular Formula | C33H37N |
| Molecular Weight | 447.67 g/mol |
| Exact Mass | 447.29 |
| IUPAC Name | 3,6-bis(4-tert-butylphenyl)-3-methyl-4,9-dihydrocarbazole |
| SMILES | CC(C)(C)c1ccc(-c2ccc3[nH]c4c(c3c2)CC(C)(c2ccc(C(C)(C)C)cc2)C=C4)cc1 |
| InChI | InChI=1S/C33H37N/c1-31(2,3)24-11-8-22(9-12-24)23-10-17-29-27(20-23)28-21-33(7,19-18-30(28)34-29)26-15-13-25(14-16-26)32(4,5)6/h8-20,34H,21H2,1-7H3 |
| InChIKey | LJHWZDHTCIZJRW-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.67 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3,6-bis(4-tert-butylphenyl)-3-methyl-4,9-dihydrocarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-bis(4-tert-butylphenyl)-3-methyl-4,9-dihydrocarbazole?
The IUPAC name of 3,6-bis(4-tert-butylphenyl)-3-methyl-4,9-dihydrocarbazole (CID 172627203) is 3,6-bis(4-tert-butylphenyl)-3-methyl-4,9-dihydrocarbazole.
What is the SMILES notation for 3,6-bis(4-tert-butylphenyl)-3-methyl-4,9-dihydrocarbazole?
The canonical SMILES for 3,6-bis(4-tert-butylphenyl)-3-methyl-4,9-dihydrocarbazole is CC(C)(C)c1ccc(-c2ccc3[nH]c4c(c3c2)CC(C)(c2ccc(C(C)(C)C)cc2)C=C4)cc1.
What is the InChIKey of 3,6-bis(4-tert-butylphenyl)-3-methyl-4,9-dihydrocarbazole?
The InChIKey is LJHWZDHTCIZJRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H37N/c1-31(2,3)24-11-8-22(9-12-24)23-10-17-29-27(20-23)28-21-33(7,19-18-30(28)34-29)26-15-13-25(14-16-26)32(4,5)6/h8-20,34H,21H2,1-7H3.
What are the key properties of 3,6-bis(4-tert-butylphenyl)-3-methyl-4,9-dihydrocarbazole?
3,6-bis(4-tert-butylphenyl)-3-methyl-4,9-dihydrocarbazole has a molecular weight of 447.67 g/mol, XLogP of 8.96, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-bis(4-tert-butylphenyl)-3-methyl-4,9-dihydrocarbazole is sourced from PubChem (CID 172627203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).