C14H23NO — CID 172627955
8-(1-methoxycyclopropyl)-2-prop-2-enyl-1,2,3,5,6,7-hexahydropyrrolizine (PubChem CID 172627955) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 8-(1-methoxycyclopropyl)-2-prop-2-enyl-1,2,3,5,6,7-hexahydropyrrolizine.
| Compound Name | 8-(1-methoxycyclopropyl)-2-prop-2-enyl-1,2,3,5,6,7-hexahydropyrrolizine |
|---|---|
| PubChem CID | 172627955 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 8-(1-methoxycyclopropyl)-2-prop-2-enyl-1,2,3,5,6,7-hexahydropyrrolizine |
| SMILES | C=CCC1CN2CCCC2(C2(OC)CC2)C1 |
| InChI | InChI=1S/C14H23NO/c1-3-5-12-10-13(14(16-2)7-8-14)6-4-9-15(13)11-12/h3,12H,1,4-11H2,2H3 |
| InChIKey | ITSRICNWVZCFEG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|