C7H10FN — CID 172628021
2-fluoro-2,3,7,8-tetrahydro-1H-pyrrolizine (PubChem CID 172628021) has the molecular formula C7H10FN and a molecular weight of 127.16 g/mol. Its IUPAC name is 2-fluoro-2,3,7,8-tetrahydro-1H-pyrrolizine.
| Compound Name | 2-fluoro-2,3,7,8-tetrahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 172628021 |
| Molecular Formula | C7H10FN |
| Molecular Weight | 127.16 g/mol |
| Exact Mass | 127.08 |
| IUPAC Name | 2-fluoro-2,3,7,8-tetrahydro-1H-pyrrolizine |
| SMILES | FC1CC2CC=CN2C1 |
| InChI | InChI=1S/C7H10FN/c8-6-4-7-2-1-3-9(7)5-6/h1,3,6-7H,2,4-5H2 |
| InChIKey | DGCSDAUZXWMOMB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.16 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |