C23H36F2N2O2 — CID 172628065
(6E,8S)-6-(fluoromethylidene)-5-[2-[[(6Z,8S)-6-(fluoromethylidene)-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methoxy]ethyl]-8-(propan-2-yloxymethyl)-2,3,5,7-tetrahydro-1H-pyrrolizine (PubChem CID 172628065) has the molecular formula C23H36F2N2O2 and a molecular weight of 410.55 g/mol. Its IUPAC name is (6E,8S)-6-(fluoromethylidene)-5-[2-[[(6Z,8S)-6-(fluoromethylidene)-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methoxy]ethyl]-8-(propan-2-yloxymethyl)-2,3,5,7-tetrahydro-1H-pyrrolizine.
| Compound Name | (6E,8S)-6-(fluoromethylidene)-5-[2-[[(6Z,8S)-6-(fluoromethylidene)-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methoxy]ethyl]-8-(propan-2-yloxymethyl)-2,3,5,7-tetrahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 172628065 |
| Molecular Formula | C23H36F2N2O2 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | (6E,8S)-6-(fluoromethylidene)-5-[2-[[(6Z,8S)-6-(fluoromethylidene)-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methoxy]ethyl]-8-(propan-2-yloxymethyl)-2,3,5,7-tetrahydro-1H-pyrrolizine |
| SMILES | CC(C)OC[C@@]12CCCN1C(CCOC[C@@]13CCCN1C/C(=C\F)C3)/C(=C/F)C2 |
| InChI | InChI=1S/C23H36F2N2O2/c1-18(2)29-17-23-7-4-9-27(23)21(20(12-23)14-25)5-10-28-16-22-6-3-8-26(22)15-19(11-22)13-24/h13-14,18,21H,3-12,15-17H2,1-2H3/b19-13-,20-14+/t21?,22-,23-/m0/s1 |
| InChIKey | DZAVZDUEOMLXGT-XZZLXVQQSA-N |
| XLogP | 4.37 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|