About methyl 6,7-dideuterio-1,5-dimethyl-3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylate
methyl 6,7-dideuterio-1,5-dimethyl-3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 172628438) has the molecular formula C11H17NO3
and a molecular weight of 213.27 g/mol. Its IUPAC name is methyl 6,7-dideuterio-1,5-dimethyl-3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylate.
Molecular Properties
| Compound Name | methyl 6,7-dideuterio-1,5-dimethyl-3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylate |
| PubChem CID | 172628438 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 213.27 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | methyl 6,7-dideuterio-1,5-dimethyl-3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | [2H]C1C([2H])C2(C)CC(=O)CC1(C)N2C(=O)OC |
| InChI | InChI=1S/C11H17NO3/c1-10-4-5-11(2,7-8(13)6-10)12(10)9(14)15-3/h4-7H2,1-3H3/i4D,5D |
| InChIKey | FPQHVWHUGYPZRF-KFRNQKGQSA-N |
| XLogP | 1.73 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 6,7-dideuterio-1,5-dimethyl-3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6,7-dideuterio-1,5-dimethyl-3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylate?
The IUPAC name of methyl 6,7-dideuterio-1,5-dimethyl-3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylate (CID 172628438) is methyl 6,7-dideuterio-1,5-dimethyl-3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylate.
What is the SMILES notation for methyl 6,7-dideuterio-1,5-dimethyl-3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylate?
The canonical SMILES for methyl 6,7-dideuterio-1,5-dimethyl-3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylate is [2H]C1C([2H])C2(C)CC(=O)CC1(C)N2C(=O)OC.
What is the InChIKey of methyl 6,7-dideuterio-1,5-dimethyl-3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylate?
The InChIKey is FPQHVWHUGYPZRF-KFRNQKGQSA-N. The full InChI is InChI=1S/C11H17NO3/c1-10-4-5-11(2,7-8(13)6-10)12(10)9(14)15-3/h4-7H2,1-3H3/i4D,5D.
What are the key properties of methyl 6,7-dideuterio-1,5-dimethyl-3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylate?
methyl 6,7-dideuterio-1,5-dimethyl-3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylate has a molecular weight of 213.27 g/mol, XLogP of 1.73, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6,7-dideuterio-1,5-dimethyl-3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylate is sourced from PubChem (CID 172628438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).