C21H38Cl2O4Si2 — CID 172628461
1,5-bis[[tert-butyl(dimethyl)silyl]oxy-dideuteriomethyl]-2,4-dichloro-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 172628461) has the molecular formula C21H38Cl2O4Si2 and a molecular weight of 485.63 g/mol. Its IUPAC name is 1,5-bis[[tert-butyl(dimethyl)silyl]oxy-dideuteriomethyl]-2,4-dichloro-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | 1,5-bis[[tert-butyl(dimethyl)silyl]oxy-dideuteriomethyl]-2,4-dichloro-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 172628461 |
| Molecular Formula | C21H38Cl2O4Si2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 1,5-bis[[tert-butyl(dimethyl)silyl]oxy-dideuteriomethyl]-2,4-dichloro-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | [2H]C([2H])(O[Si](C)(C)C(C)(C)C)C12C=CC(C([2H])([2H])O[Si](C)(C)C(C)(C)C)(O1)C(Cl)C(=O)C2Cl |
| InChI | InChI=1S/C21H38Cl2O4Si2/c1-18(2,3)28(7,8)25-13-20-11-12-21(27-20,17(23)15(24)16(20)22)14-26-29(9,10)19(4,5)6/h11-12,16-17H,13-14H2,1-10H3/i13D2,14D2 |
| InChIKey | FXWGDGBPVYRRTH-RYIWKTDQSA-N |
| XLogP | 5.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|