C31H40FN5O3Si — CID 172628532
4-cyano-N-[2-(4,4-dimethylcyclohexen-1-yl)-6-(2-fluoro-8-oxabicyclo[3.2.1]oct-6-en-3-yl)-3-pyridinyl]-1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxamide (PubChem CID 172628532) has the molecular formula C31H40FN5O3Si and a molecular weight of 577.78 g/mol. Its IUPAC name is 4-cyano-N-[2-(4,4-dimethylcyclohexen-1-yl)-6-(2-fluoro-8-oxabicyclo[3.2.1]oct-6-en-3-yl)-3-pyridinyl]-1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxamide.
| Compound Name | 4-cyano-N-[2-(4,4-dimethylcyclohexen-1-yl)-6-(2-fluoro-8-oxabicyclo[3.2.1]oct-6-en-3-yl)-3-pyridinyl]-1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxamide |
|---|---|
| PubChem CID | 172628532 |
| Molecular Formula | C31H40FN5O3Si |
| Molecular Weight | 577.78 g/mol |
| Exact Mass | 577.29 |
| IUPAC Name | 4-cyano-N-[2-(4,4-dimethylcyclohexen-1-yl)-6-(2-fluoro-8-oxabicyclo[3.2.1]oct-6-en-3-yl)-3-pyridinyl]-1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxamide |
| SMILES | CC1(C)CC=C(c2nc(C3CC4C=CC(O4)C3F)ccc2NC(=O)c2nc(C#N)cn2COCC[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C31H40FN5O3Si/c1-31(2)12-10-20(11-13-31)28-25(8-7-24(35-28)23-16-22-6-9-26(40-22)27(23)32)36-30(38)29-34-21(17-33)18-37(29)19-39-14-15-41(3,4)5/h6-10,18,22-23,26-27H,11-16,19H2,1-5H3,(H,36,38) |
| InChIKey | OLIASBZFNFPHMT-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.78 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|