C21H42O4Si2 — CID 172628597
1,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-6,7-dideuterio-8-oxabicyclo[3.2.1]octan-3-one (PubChem CID 172628597) has the molecular formula C21H42O4Si2 and a molecular weight of 416.75 g/mol. Its IUPAC name is 1,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-6,7-dideuterio-8-oxabicyclo[3.2.1]octan-3-one.
| Compound Name | 1,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-6,7-dideuterio-8-oxabicyclo[3.2.1]octan-3-one |
|---|---|
| PubChem CID | 172628597 |
| Molecular Formula | C21H42O4Si2 |
| Molecular Weight | 416.75 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | 1,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-6,7-dideuterio-8-oxabicyclo[3.2.1]octan-3-one |
| SMILES | [2H]C1C([2H])C2(CO[Si](C)(C)C(C)(C)C)CC(=O)CC1(CO[Si](C)(C)C(C)(C)C)O2 |
| InChI | InChI=1S/C21H42O4Si2/c1-18(2,3)26(7,8)23-15-20-11-12-21(25-20,14-17(22)13-20)16-24-27(9,10)19(4,5)6/h11-16H2,1-10H3/i11D,12D |
| InChIKey | GEXKQEBPJMHHLJ-USUSYXOVSA-N |
| XLogP | 5.68 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.75 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|