C11H14Cl2O2 — CID 172628686
2,4-dichloro-1,5,6,7-tetramethyl-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 172628686) has the molecular formula C11H14Cl2O2 and a molecular weight of 249.14 g/mol. Its IUPAC name is 2,4-dichloro-1,5,6,7-tetramethyl-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | 2,4-dichloro-1,5,6,7-tetramethyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 172628686 |
| Molecular Formula | C11H14Cl2O2 |
| Molecular Weight | 249.14 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 2,4-dichloro-1,5,6,7-tetramethyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | CC1=C(C)C2(C)OC1(C)C(Cl)C(=O)C2Cl |
| InChI | InChI=1S/C11H14Cl2O2/c1-5-6(2)11(4)9(13)7(14)8(12)10(5,3)15-11/h8-9H,1-4H3 |
| InChIKey | PGGHMXPHMAVJHA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.14 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|