C27H35N7O5 — CID 172628759
4-[[6-(1-methylpiperidin-4-yl)oxy-2-pyridinyl]amino]-2-[3-(trihydroxymethyl)anilino]pyrimidine-5-carbaldehyde;N-methylprop-2-en-1-amine (PubChem CID 172628759) has the molecular formula C27H35N7O5 and a molecular weight of 537.62 g/mol. Its IUPAC name is 4-[[6-(1-methylpiperidin-4-yl)oxy-2-pyridinyl]amino]-2-[3-(trihydroxymethyl)anilino]pyrimidine-5-carbaldehyde;N-methylprop-2-en-1-amine.
| Compound Name | 4-[[6-(1-methylpiperidin-4-yl)oxy-2-pyridinyl]amino]-2-[3-(trihydroxymethyl)anilino]pyrimidine-5-carbaldehyde;N-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 172628759 |
| Molecular Formula | C27H35N7O5 |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | 4-[[6-(1-methylpiperidin-4-yl)oxy-2-pyridinyl]amino]-2-[3-(trihydroxymethyl)anilino]pyrimidine-5-carbaldehyde;N-methylprop-2-en-1-amine |
| SMILES | C=CCNC.CN1CCC(Oc2cccc(Nc3nc(Nc4cccc(C(O)(O)O)c4)ncc3C=O)n2)CC1 |
| InChI | InChI=1S/C23H26N6O5.C4H9N/c1-29-10-8-18(9-11-29)34-20-7-3-6-19(26-20)27-21-15(14-30)13-24-22(28-21)25-17-5-2-4-16(12-17)23(31,32)33;1-3-4-5-2/h2-7,12-14,18,31-33H,8-11H2,1H3,(H2,24,25,26,27,28);3,5H,1,4H2,2H3 |
| InChIKey | JWIFPUSHQMBVNV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 164.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|