C11H7F7N2S — CID 17262892
1-cyclopropyl-3-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]thiourea (PubChem CID 17262892) has the molecular formula C11H7F7N2S and a molecular weight of 332.24 g/mol. Its IUPAC name is 1-cyclopropyl-3-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-cyclopropyl-3-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 17262892 |
| Molecular Formula | C11H7F7N2S |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 1-cyclopropyl-3-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]thiourea |
| SMILES | Fc1c(F)c(C(F)(F)F)c(F)c(F)c1NC(=S)NC1CC1 |
| InChI | InChI=1S/C11H7F7N2S/c12-5-4(11(16,17)18)6(13)8(15)9(7(5)14)20-10(21)19-3-1-2-3/h3H,1-2H2,(H2,19,20,21) |
| InChIKey | WGCNXEJBNMXOOB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|