C29H34N8O2S — CID 172629024
1-[6-(1-methylpiperidin-4-yl)oxy-2-pyridinyl]-2-prop-2-enyl-6-(4-thiomorpholin-4-ylanilino)pyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 172629024) has the molecular formula C29H34N8O2S and a molecular weight of 558.71 g/mol. Its IUPAC name is 1-[6-(1-methylpiperidin-4-yl)oxy-2-pyridinyl]-2-prop-2-enyl-6-(4-thiomorpholin-4-ylanilino)pyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 1-[6-(1-methylpiperidin-4-yl)oxy-2-pyridinyl]-2-prop-2-enyl-6-(4-thiomorpholin-4-ylanilino)pyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 172629024 |
| Molecular Formula | C29H34N8O2S |
| Molecular Weight | 558.71 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | 1-[6-(1-methylpiperidin-4-yl)oxy-2-pyridinyl]-2-prop-2-enyl-6-(4-thiomorpholin-4-ylanilino)pyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc(N4CCSCC4)cc3)nc2n1-c1cccc(OC2CCN(C)CC2)n1 |
| InChI | InChI=1S/C29H34N8O2S/c1-3-13-36-28(38)24-20-30-29(31-21-7-9-22(10-8-21)35-16-18-40-19-17-35)33-27(24)37(36)25-5-4-6-26(32-25)39-23-11-14-34(2)15-12-23/h3-10,20,23H,1,11-19H2,2H3,(H,30,31,33) |
| InChIKey | OJGFEZMBBHDXAI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 93.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.71 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|