About ethane;N-methyl-1-[2-(1-methylpiperidin-4-yl)ethyl]-4-(2,2,2-trifluoroethoxy)piperidin-4-amine
ethane;N-methyl-1-[2-(1-methylpiperidin-4-yl)ethyl]-4-(2,2,2-trifluoroethoxy)piperidin-4-amine (PubChem CID 172630185) has the molecular formula C18H36F3N3O
and a molecular weight of 367.50 g/mol. Its IUPAC name is ethane;N-methyl-1-[2-(1-methylpiperidin-4-yl)ethyl]-4-(2,2,2-trifluoroethoxy)piperidin-4-amine.
Molecular Properties
| Compound Name | ethane;N-methyl-1-[2-(1-methylpiperidin-4-yl)ethyl]-4-(2,2,2-trifluoroethoxy)piperidin-4-amine |
| PubChem CID | 172630185 |
| Molecular Formula | C18H36F3N3O |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.28 |
| IUPAC Name | ethane;N-methyl-1-[2-(1-methylpiperidin-4-yl)ethyl]-4-(2,2,2-trifluoroethoxy)piperidin-4-amine |
| SMILES | CC.CNC1(OCC(F)(F)F)CCN(CCC2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C16H30F3N3O.C2H6/c1-20-15(23-13-16(17,18)19)6-11-22(12-7-15)10-5-14-3-8-21(2)9-4-14;1-2/h14,20H,3-13H2,1-2H3;1-2H3 |
| InChIKey | CXTOZJMMRQDJPT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-methyl-1-[2-(1-methylpiperidin-4-yl)ethyl]-4-(2,2,2-trifluoroethoxy)piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methyl-1-[2-(1-methylpiperidin-4-yl)ethyl]-4-(2,2,2-trifluoroethoxy)piperidin-4-amine?
The IUPAC name of ethane;N-methyl-1-[2-(1-methylpiperidin-4-yl)ethyl]-4-(2,2,2-trifluoroethoxy)piperidin-4-amine (CID 172630185) is ethane;N-methyl-1-[2-(1-methylpiperidin-4-yl)ethyl]-4-(2,2,2-trifluoroethoxy)piperidin-4-amine.
What is the SMILES notation for ethane;N-methyl-1-[2-(1-methylpiperidin-4-yl)ethyl]-4-(2,2,2-trifluoroethoxy)piperidin-4-amine?
The canonical SMILES for ethane;N-methyl-1-[2-(1-methylpiperidin-4-yl)ethyl]-4-(2,2,2-trifluoroethoxy)piperidin-4-amine is CC.CNC1(OCC(F)(F)F)CCN(CCC2CCN(C)CC2)CC1.
What is the InChIKey of ethane;N-methyl-1-[2-(1-methylpiperidin-4-yl)ethyl]-4-(2,2,2-trifluoroethoxy)piperidin-4-amine?
The InChIKey is CXTOZJMMRQDJPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30F3N3O.C2H6/c1-20-15(23-13-16(17,18)19)6-11-22(12-7-15)10-5-14-3-8-21(2)9-4-14;1-2/h14,20H,3-13H2,1-2H3;1-2H3.
What are the key properties of ethane;N-methyl-1-[2-(1-methylpiperidin-4-yl)ethyl]-4-(2,2,2-trifluoroethoxy)piperidin-4-amine?
ethane;N-methyl-1-[2-(1-methylpiperidin-4-yl)ethyl]-4-(2,2,2-trifluoroethoxy)piperidin-4-amine has a molecular weight of 367.50 g/mol, XLogP of 3.33, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methyl-1-[2-(1-methylpiperidin-4-yl)ethyl]-4-(2,2,2-trifluoroethoxy)piperidin-4-amine is sourced from PubChem (CID 172630185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).