About 3-fluoro-1,5-dimethyl-6-methylidenepyridin-2-amine
3-fluoro-1,5-dimethyl-6-methylidenepyridin-2-amine (PubChem CID 172631680) has the molecular formula C8H11FN2
and a molecular weight of 154.19 g/mol. Its IUPAC name is 3-fluoro-1,5-dimethyl-6-methylidenepyridin-2-amine.
Molecular Properties
| Compound Name | 3-fluoro-1,5-dimethyl-6-methylidenepyridin-2-amine |
| PubChem CID | 172631680 |
| Molecular Formula | C8H11FN2 |
| Molecular Weight | 154.19 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | 3-fluoro-1,5-dimethyl-6-methylidenepyridin-2-amine |
| SMILES | C=C1C(C)=CC(F)=C(N)N1C |
| InChI | InChI=1S/C8H11FN2/c1-5-4-7(9)8(10)11(3)6(5)2/h4H,2,10H2,1,3H3 |
| InChIKey | BPJSGXIMORGXPC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.19 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-fluoro-1,5-dimethyl-6-methylidenepyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-1,5-dimethyl-6-methylidenepyridin-2-amine?
The IUPAC name of 3-fluoro-1,5-dimethyl-6-methylidenepyridin-2-amine (CID 172631680) is 3-fluoro-1,5-dimethyl-6-methylidenepyridin-2-amine.
What is the SMILES notation for 3-fluoro-1,5-dimethyl-6-methylidenepyridin-2-amine?
The canonical SMILES for 3-fluoro-1,5-dimethyl-6-methylidenepyridin-2-amine is C=C1C(C)=CC(F)=C(N)N1C.
What is the InChIKey of 3-fluoro-1,5-dimethyl-6-methylidenepyridin-2-amine?
The InChIKey is BPJSGXIMORGXPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11FN2/c1-5-4-7(9)8(10)11(3)6(5)2/h4H,2,10H2,1,3H3.
What are the key properties of 3-fluoro-1,5-dimethyl-6-methylidenepyridin-2-amine?
3-fluoro-1,5-dimethyl-6-methylidenepyridin-2-amine has a molecular weight of 154.19 g/mol, XLogP of 1.49, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-1,5-dimethyl-6-methylidenepyridin-2-amine is sourced from PubChem (CID 172631680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).