C24H23FN2O2 — CID 172632477
[4-[[2-(5-fluoro-3-pyridinyl)phenoxy]methyl]phenyl]-piperidin-1-ylmethanone (PubChem CID 172632477) has the molecular formula C24H23FN2O2 and a molecular weight of 390.46 g/mol. Its IUPAC name is [4-[[2-(5-fluoro-3-pyridinyl)phenoxy]methyl]phenyl]-piperidin-1-ylmethanone.
| Compound Name | [4-[[2-(5-fluoro-3-pyridinyl)phenoxy]methyl]phenyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 172632477 |
| Molecular Formula | C24H23FN2O2 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | [4-[[2-(5-fluoro-3-pyridinyl)phenoxy]methyl]phenyl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1ccc(COc2ccccc2-c2cncc(F)c2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C24H23FN2O2/c25-21-14-20(15-26-16-21)22-6-2-3-7-23(22)29-17-18-8-10-19(11-9-18)24(28)27-12-4-1-5-13-27/h2-3,6-11,14-16H,1,4-5,12-13,17H2 |
| InChIKey | LROSLXPSDXFFIJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |