C20H27F4N3O — CID 172633777
N-(4-cyclobutyl-5-cyclohexyl-2-methylpyrazol-3-yl)-2-[(1S)-2,2,3,3-tetrafluorocyclobutyl]acetamide (PubChem CID 172633777) has the molecular formula C20H27F4N3O and a molecular weight of 401.45 g/mol. Its IUPAC name is N-(4-cyclobutyl-5-cyclohexyl-2-methylpyrazol-3-yl)-2-[(1S)-2,2,3,3-tetrafluorocyclobutyl]acetamide.
| Compound Name | N-(4-cyclobutyl-5-cyclohexyl-2-methylpyrazol-3-yl)-2-[(1S)-2,2,3,3-tetrafluorocyclobutyl]acetamide |
|---|---|
| PubChem CID | 172633777 |
| Molecular Formula | C20H27F4N3O |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | N-(4-cyclobutyl-5-cyclohexyl-2-methylpyrazol-3-yl)-2-[(1S)-2,2,3,3-tetrafluorocyclobutyl]acetamide |
| SMILES | Cn1nc(C2CCCCC2)c(C2CCC2)c1NC(=O)C[C@H]1CC(F)(F)C1(F)F |
| InChI | InChI=1S/C20H27F4N3O/c1-27-18(25-15(28)10-14-11-19(21,22)20(14,23)24)16(12-8-5-9-12)17(26-27)13-6-3-2-4-7-13/h12-14H,2-11H2,1H3,(H,25,28)/t14-/m0/s1 |
| InChIKey | KFPYZPQJYWGLJH-AWEZNQCLSA-N |
| XLogP | 5.35 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|