C11H12FNO2 — CID 172635030
6-methoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl fluoride (PubChem CID 172635030) has the molecular formula C11H12FNO2 and a molecular weight of 209.22 g/mol. Its IUPAC name is 6-methoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl fluoride.
| Compound Name | 6-methoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl fluoride |
|---|---|
| PubChem CID | 172635030 |
| Molecular Formula | C11H12FNO2 |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 6-methoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl fluoride |
| SMILES | COc1ccc2c(c1)CCN(C(=O)F)C2 |
| InChI | InChI=1S/C11H12FNO2/c1-15-10-3-2-9-7-13(11(12)14)5-4-8(9)6-10/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | NFUYYWKQLRBZCU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|