About 4,5'-difluoro-2'-methylspiro[3H-indene-2,3'-indole]-1-one
4,5'-difluoro-2'-methylspiro[3H-indene-2,3'-indole]-1-one (PubChem CID 172635570) has the molecular formula C17H11F2NO
and a molecular weight of 283.28 g/mol. Its IUPAC name is 4,5'-difluoro-2'-methylspiro[3H-indene-2,3'-indole]-1-one.
Molecular Properties
| Compound Name | 4,5'-difluoro-2'-methylspiro[3H-indene-2,3'-indole]-1-one |
| PubChem CID | 172635570 |
| Molecular Formula | C17H11F2NO |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 4,5'-difluoro-2'-methylspiro[3H-indene-2,3'-indole]-1-one |
| SMILES | CC1=Nc2ccc(F)cc2C12Cc1c(F)cccc1C2=O |
| InChI | InChI=1S/C17H11F2NO/c1-9-17(13-7-10(18)5-6-15(13)20-9)8-12-11(16(17)21)3-2-4-14(12)19/h2-7H,8H2,1H3 |
| InChIKey | PKTMHQSNZSOQKD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5'-difluoro-2'-methylspiro[3H-indene-2,3'-indole]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5'-difluoro-2'-methylspiro[3H-indene-2,3'-indole]-1-one?
The IUPAC name of 4,5'-difluoro-2'-methylspiro[3H-indene-2,3'-indole]-1-one (CID 172635570) is 4,5'-difluoro-2'-methylspiro[3H-indene-2,3'-indole]-1-one.
What is the SMILES notation for 4,5'-difluoro-2'-methylspiro[3H-indene-2,3'-indole]-1-one?
The canonical SMILES for 4,5'-difluoro-2'-methylspiro[3H-indene-2,3'-indole]-1-one is CC1=Nc2ccc(F)cc2C12Cc1c(F)cccc1C2=O.
What is the InChIKey of 4,5'-difluoro-2'-methylspiro[3H-indene-2,3'-indole]-1-one?
The InChIKey is PKTMHQSNZSOQKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11F2NO/c1-9-17(13-7-10(18)5-6-15(13)20-9)8-12-11(16(17)21)3-2-4-14(12)19/h2-7H,8H2,1H3.
What are the key properties of 4,5'-difluoro-2'-methylspiro[3H-indene-2,3'-indole]-1-one?
4,5'-difluoro-2'-methylspiro[3H-indene-2,3'-indole]-1-one has a molecular weight of 283.28 g/mol, XLogP of 3.75, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5'-difluoro-2'-methylspiro[3H-indene-2,3'-indole]-1-one is sourced from PubChem (CID 172635570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).