About 4-fluoro-2'-methyl-5'-thiophen-3-ylspiro[3H-indene-2,3'-indole]-1-one
4-fluoro-2'-methyl-5'-thiophen-3-ylspiro[3H-indene-2,3'-indole]-1-one (PubChem CID 172635572) has the molecular formula C21H14FNOS
and a molecular weight of 347.41 g/mol. Its IUPAC name is 4-fluoro-2'-methyl-5'-thiophen-3-ylspiro[3H-indene-2,3'-indole]-1-one.
Molecular Properties
| Compound Name | 4-fluoro-2'-methyl-5'-thiophen-3-ylspiro[3H-indene-2,3'-indole]-1-one |
| PubChem CID | 172635572 |
| Molecular Formula | C21H14FNOS |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 4-fluoro-2'-methyl-5'-thiophen-3-ylspiro[3H-indene-2,3'-indole]-1-one |
| SMILES | CC1=Nc2ccc(-c3ccsc3)cc2C12Cc1c(F)cccc1C2=O |
| InChI | InChI=1S/C21H14FNOS/c1-12-21(10-16-15(20(21)24)3-2-4-18(16)22)17-9-13(5-6-19(17)23-12)14-7-8-25-11-14/h2-9,11H,10H2,1H3 |
| InChIKey | ODFMKJWZPOXCCS-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-fluoro-2'-methyl-5'-thiophen-3-ylspiro[3H-indene-2,3'-indole]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-2'-methyl-5'-thiophen-3-ylspiro[3H-indene-2,3'-indole]-1-one?
The IUPAC name of 4-fluoro-2'-methyl-5'-thiophen-3-ylspiro[3H-indene-2,3'-indole]-1-one (CID 172635572) is 4-fluoro-2'-methyl-5'-thiophen-3-ylspiro[3H-indene-2,3'-indole]-1-one.
What is the SMILES notation for 4-fluoro-2'-methyl-5'-thiophen-3-ylspiro[3H-indene-2,3'-indole]-1-one?
The canonical SMILES for 4-fluoro-2'-methyl-5'-thiophen-3-ylspiro[3H-indene-2,3'-indole]-1-one is CC1=Nc2ccc(-c3ccsc3)cc2C12Cc1c(F)cccc1C2=O.
What is the InChIKey of 4-fluoro-2'-methyl-5'-thiophen-3-ylspiro[3H-indene-2,3'-indole]-1-one?
The InChIKey is ODFMKJWZPOXCCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14FNOS/c1-12-21(10-16-15(20(21)24)3-2-4-18(16)22)17-9-13(5-6-19(17)23-12)14-7-8-25-11-14/h2-9,11H,10H2,1H3.
What are the key properties of 4-fluoro-2'-methyl-5'-thiophen-3-ylspiro[3H-indene-2,3'-indole]-1-one?
4-fluoro-2'-methyl-5'-thiophen-3-ylspiro[3H-indene-2,3'-indole]-1-one has a molecular weight of 347.41 g/mol, XLogP of 5.34, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-2'-methyl-5'-thiophen-3-ylspiro[3H-indene-2,3'-indole]-1-one is sourced from PubChem (CID 172635572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).