About (2S,3S)-2-methyl-1-(4-methylphenyl)sulfonylspiro[2H-indole-3,2'-3H-indene]-1'-one
(2S,3S)-2-methyl-1-(4-methylphenyl)sulfonylspiro[2H-indole-3,2'-3H-indene]-1'-one (PubChem CID 172635611) has the molecular formula C24H21NO3S
and a molecular weight of 403.50 g/mol. Its IUPAC name is (2S,3S)-2-methyl-1-(4-methylphenyl)sulfonylspiro[2H-indole-3,2'-3H-indene]-1'-one.
Molecular Properties
| Compound Name | (2S,3S)-2-methyl-1-(4-methylphenyl)sulfonylspiro[2H-indole-3,2'-3H-indene]-1'-one |
| PubChem CID | 172635611 |
| Molecular Formula | C24H21NO3S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | (2S,3S)-2-methyl-1-(4-methylphenyl)sulfonylspiro[2H-indole-3,2'-3H-indene]-1'-one |
| SMILES | Cc1ccc(S(=O)(=O)N2c3ccccc3[C@@]3(Cc4ccccc4C3=O)[C@@H]2C)cc1 |
| InChI | InChI=1S/C24H21NO3S/c1-16-11-13-19(14-12-16)29(27,28)25-17(2)24(21-9-5-6-10-22(21)25)15-18-7-3-4-8-20(18)23(24)26/h3-14,17H,15H2,1-2H3/t17-,24+/m0/s1 |
| InChIKey | WTRGKXOTSULWKQ-BXKMTCNYSA-N |
| XLogP | 4.27 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,3S)-2-methyl-1-(4-methylphenyl)sulfonylspiro[2H-indole-3,2'-3H-indene]-1'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-2-methyl-1-(4-methylphenyl)sulfonylspiro[2H-indole-3,2'-3H-indene]-1'-one?
The IUPAC name of (2S,3S)-2-methyl-1-(4-methylphenyl)sulfonylspiro[2H-indole-3,2'-3H-indene]-1'-one (CID 172635611) is (2S,3S)-2-methyl-1-(4-methylphenyl)sulfonylspiro[2H-indole-3,2'-3H-indene]-1'-one.
What is the SMILES notation for (2S,3S)-2-methyl-1-(4-methylphenyl)sulfonylspiro[2H-indole-3,2'-3H-indene]-1'-one?
The canonical SMILES for (2S,3S)-2-methyl-1-(4-methylphenyl)sulfonylspiro[2H-indole-3,2'-3H-indene]-1'-one is Cc1ccc(S(=O)(=O)N2c3ccccc3[C@@]3(Cc4ccccc4C3=O)[C@@H]2C)cc1.
What is the InChIKey of (2S,3S)-2-methyl-1-(4-methylphenyl)sulfonylspiro[2H-indole-3,2'-3H-indene]-1'-one?
The InChIKey is WTRGKXOTSULWKQ-BXKMTCNYSA-N. The full InChI is InChI=1S/C24H21NO3S/c1-16-11-13-19(14-12-16)29(27,28)25-17(2)24(21-9-5-6-10-22(21)25)15-18-7-3-4-8-20(18)23(24)26/h3-14,17H,15H2,1-2H3/t17-,24+/m0/s1.
What are the key properties of (2S,3S)-2-methyl-1-(4-methylphenyl)sulfonylspiro[2H-indole-3,2'-3H-indene]-1'-one?
(2S,3S)-2-methyl-1-(4-methylphenyl)sulfonylspiro[2H-indole-3,2'-3H-indene]-1'-one has a molecular weight of 403.50 g/mol, XLogP of 4.27, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2-methyl-1-(4-methylphenyl)sulfonylspiro[2H-indole-3,2'-3H-indene]-1'-one is sourced from PubChem (CID 172635611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).