About 6-chloro-1'-(2-chloroacetyl)-5'-fluoro-2'-methylidenespiro[3H-indene-2,3'-indole]-1-one
6-chloro-1'-(2-chloroacetyl)-5'-fluoro-2'-methylidenespiro[3H-indene-2,3'-indole]-1-one (PubChem CID 172635627) has the molecular formula C19H12Cl2FNO2
and a molecular weight of 376.21 g/mol. Its IUPAC name is 6-chloro-1'-(2-chloroacetyl)-5'-fluoro-2'-methylidenespiro[3H-indene-2,3'-indole]-1-one.
Molecular Properties
| Compound Name | 6-chloro-1'-(2-chloroacetyl)-5'-fluoro-2'-methylidenespiro[3H-indene-2,3'-indole]-1-one |
| PubChem CID | 172635627 |
| Molecular Formula | C19H12Cl2FNO2 |
| Molecular Weight | 376.21 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | 6-chloro-1'-(2-chloroacetyl)-5'-fluoro-2'-methylidenespiro[3H-indene-2,3'-indole]-1-one |
| SMILES | C=C1N(C(=O)CCl)c2ccc(F)cc2C12Cc1ccc(Cl)cc1C2=O |
| InChI | InChI=1S/C19H12Cl2FNO2/c1-10-19(8-11-2-3-12(21)6-14(11)18(19)25)15-7-13(22)4-5-16(15)23(10)17(24)9-20/h2-7H,1,8-9H2 |
| InChIKey | JPXWEBLWZBGJTB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.21 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-1'-(2-chloroacetyl)-5'-fluoro-2'-methylidenespiro[3H-indene-2,3'-indole]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-1'-(2-chloroacetyl)-5'-fluoro-2'-methylidenespiro[3H-indene-2,3'-indole]-1-one?
The IUPAC name of 6-chloro-1'-(2-chloroacetyl)-5'-fluoro-2'-methylidenespiro[3H-indene-2,3'-indole]-1-one (CID 172635627) is 6-chloro-1'-(2-chloroacetyl)-5'-fluoro-2'-methylidenespiro[3H-indene-2,3'-indole]-1-one.
What is the SMILES notation for 6-chloro-1'-(2-chloroacetyl)-5'-fluoro-2'-methylidenespiro[3H-indene-2,3'-indole]-1-one?
The canonical SMILES for 6-chloro-1'-(2-chloroacetyl)-5'-fluoro-2'-methylidenespiro[3H-indene-2,3'-indole]-1-one is C=C1N(C(=O)CCl)c2ccc(F)cc2C12Cc1ccc(Cl)cc1C2=O.
What is the InChIKey of 6-chloro-1'-(2-chloroacetyl)-5'-fluoro-2'-methylidenespiro[3H-indene-2,3'-indole]-1-one?
The InChIKey is JPXWEBLWZBGJTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12Cl2FNO2/c1-10-19(8-11-2-3-12(21)6-14(11)18(19)25)15-7-13(22)4-5-16(15)23(10)17(24)9-20/h2-7H,1,8-9H2.
What are the key properties of 6-chloro-1'-(2-chloroacetyl)-5'-fluoro-2'-methylidenespiro[3H-indene-2,3'-indole]-1-one?
6-chloro-1'-(2-chloroacetyl)-5'-fluoro-2'-methylidenespiro[3H-indene-2,3'-indole]-1-one has a molecular weight of 376.21 g/mol, XLogP of 4.26, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-1'-(2-chloroacetyl)-5'-fluoro-2'-methylidenespiro[3H-indene-2,3'-indole]-1-one is sourced from PubChem (CID 172635627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).