C20H25F3N2O4S2 — CID 172636015
3-[[(1R,2E,7Z,9Z)-cyclododeca-2,7,9-trien-1-yl]amino]-4-ethylsulfonyl-2,5,6-trifluorobenzenesulfonamide (PubChem CID 172636015) has the molecular formula C20H25F3N2O4S2 and a molecular weight of 478.56 g/mol. Its IUPAC name is 3-[[(1R,2E,7Z,9Z)-cyclododeca-2,7,9-trien-1-yl]amino]-4-ethylsulfonyl-2,5,6-trifluorobenzenesulfonamide.
| Compound Name | 3-[[(1R,2E,7Z,9Z)-cyclododeca-2,7,9-trien-1-yl]amino]-4-ethylsulfonyl-2,5,6-trifluorobenzenesulfonamide |
|---|---|
| PubChem CID | 172636015 |
| Molecular Formula | C20H25F3N2O4S2 |
| Molecular Weight | 478.56 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 3-[[(1R,2E,7Z,9Z)-cyclododeca-2,7,9-trien-1-yl]amino]-4-ethylsulfonyl-2,5,6-trifluorobenzenesulfonamide |
| SMILES | CCS(=O)(=O)c1c(F)c(F)c(S(N)(=O)=O)c(F)c1N[C@H]1/C=C/CCC/C=C\C=C/CC1 |
| InChI | InChI=1S/C20H25F3N2O4S2/c1-2-30(26,27)20-16(22)15(21)19(31(24,28)29)17(23)18(20)25-14-12-10-8-6-4-3-5-7-9-11-13-14/h3-4,6,8,11,13-14,25H,2,5,7,9-10,12H2,1H3,(H2,24,28,29)/b4-3-,8-6-,13-11+/t14-/m1/s1 |
| InChIKey | TWIHJFSVQAOLGF-FIANPECBSA-N |
| XLogP | 3.96 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.56 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|