About 2-thiophen-2-ylethenyl furan-2-carboxylate
2-thiophen-2-ylethenyl furan-2-carboxylate (PubChem CID 172636082) has the molecular formula C11H8O3S
and a molecular weight of 220.25 g/mol. Its IUPAC name is 2-thiophen-2-ylethenyl furan-2-carboxylate.
Molecular Properties
| Compound Name | 2-thiophen-2-ylethenyl furan-2-carboxylate |
| PubChem CID | 172636082 |
| Molecular Formula | C11H8O3S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | 2-thiophen-2-ylethenyl furan-2-carboxylate |
| SMILES | O=C(OC=Cc1cccs1)c1ccco1 |
| InChI | InChI=1S/C11H8O3S/c12-11(10-4-1-6-13-10)14-7-5-9-3-2-8-15-9/h1-8H |
| InChIKey | SWTDMBIMDVYFEZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-thiophen-2-ylethenyl furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thiophen-2-ylethenyl furan-2-carboxylate?
The IUPAC name of 2-thiophen-2-ylethenyl furan-2-carboxylate (CID 172636082) is 2-thiophen-2-ylethenyl furan-2-carboxylate.
What is the SMILES notation for 2-thiophen-2-ylethenyl furan-2-carboxylate?
The canonical SMILES for 2-thiophen-2-ylethenyl furan-2-carboxylate is O=C(OC=Cc1cccs1)c1ccco1.
What is the InChIKey of 2-thiophen-2-ylethenyl furan-2-carboxylate?
The InChIKey is SWTDMBIMDVYFEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8O3S/c12-11(10-4-1-6-13-10)14-7-5-9-3-2-8-15-9/h1-8H.
What are the key properties of 2-thiophen-2-ylethenyl furan-2-carboxylate?
2-thiophen-2-ylethenyl furan-2-carboxylate has a molecular weight of 220.25 g/mol, XLogP of 3.17, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thiophen-2-ylethenyl furan-2-carboxylate is sourced from PubChem (CID 172636082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).