C9H5N5O3S — CID 172636120
2-(3-nitrophenyl)-5H-[1,2,4]triazolo[5,1-b][1,3,4]oxadiazole-6-thione (PubChem CID 172636120) has the molecular formula C9H5N5O3S and a molecular weight of 263.24 g/mol. Its IUPAC name is 2-(3-nitrophenyl)-5H-[1,2,4]triazolo[5,1-b][1,3,4]oxadiazole-6-thione.
| Compound Name | 2-(3-nitrophenyl)-5H-[1,2,4]triazolo[5,1-b][1,3,4]oxadiazole-6-thione |
|---|---|
| PubChem CID | 172636120 |
| Molecular Formula | C9H5N5O3S |
| Molecular Weight | 263.24 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | 2-(3-nitrophenyl)-5H-[1,2,4]triazolo[5,1-b][1,3,4]oxadiazole-6-thione |
| SMILES | O=[N+]([O-])c1cccc(-c2nn3[nH]c(=S)nc3o2)c1 |
| InChI | InChI=1S/C9H5N5O3S/c15-14(16)6-3-1-2-5(4-6)7-11-13-9(17-7)10-8(18)12-13/h1-4H,(H,12,18) |
| InChIKey | YXRULBFMODABTG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.24 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|