C27H45NO6 — CID 172636224
propan-2-yl 4-[[(Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoyl]amino]butanoate (PubChem CID 172636224) has the molecular formula C27H45NO6 and a molecular weight of 479.66 g/mol. Its IUPAC name is propan-2-yl 4-[[(Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoyl]amino]butanoate.
| Compound Name | propan-2-yl 4-[[(Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoyl]amino]butanoate |
|---|---|
| PubChem CID | 172636224 |
| Molecular Formula | C27H45NO6 |
| Molecular Weight | 479.66 g/mol |
| Exact Mass | 479.32 |
| IUPAC Name | propan-2-yl 4-[[(Z)-7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]hept-5-enoyl]amino]butanoate |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1C/C=C\CCCC(=O)NCCCC(=O)OC(C)C |
| InChI | InChI=1S/C27H45NO6/c1-4-5-8-12-21(29)16-17-23-22(24(30)19-25(23)31)13-9-6-7-10-14-26(32)28-18-11-15-27(33)34-20(2)3/h6,9,16-17,20-23,25,29,31H,4-5,7-8,10-15,18-19H2,1-3H3,(H,28,32)/b9-6-,17-16+/t21-,22+,23+,25+/m0/s1 |
| InChIKey | MXZWJVQYEKBBIF-ZILQWKDASA-N |
| XLogP | 4.01 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.66 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|