C27H34N6O — CID 172636949
2-[7-[(2S,5R)-2,5-diethyl-4-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]piperazin-1-yl]-4-methyl-5-oxopyrazolo[4,3-b]pyridin-2-yl]acetonitrile (PubChem CID 172636949) has the molecular formula C27H34N6O and a molecular weight of 458.61 g/mol. Its IUPAC name is 2-[7-[(2S,5R)-2,5-diethyl-4-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]piperazin-1-yl]-4-methyl-5-oxopyrazolo[4,3-b]pyridin-2-yl]acetonitrile.
| Compound Name | 2-[7-[(2S,5R)-2,5-diethyl-4-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]piperazin-1-yl]-4-methyl-5-oxopyrazolo[4,3-b]pyridin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 172636949 |
| Molecular Formula | C27H34N6O |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | 2-[7-[(2S,5R)-2,5-diethyl-4-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]piperazin-1-yl]-4-methyl-5-oxopyrazolo[4,3-b]pyridin-2-yl]acetonitrile |
| SMILES | CC[C@H]1CN([C@@H]2CCCc3ccccc32)[C@H](CC)CN1c1cc(=O)n(C)c2cn(CC#N)nc12 |
| InChI | InChI=1S/C27H34N6O/c1-4-20-17-33(24-15-26(34)30(3)25-18-31(14-13-28)29-27(24)25)21(5-2)16-32(20)23-12-8-10-19-9-6-7-11-22(19)23/h6-7,9,11,15,18,20-21,23H,4-5,8,10,12,14,16-17H2,1-3H3/t20-,21+,23-/m1/s1 |
| InChIKey | OQIUXZNURWCXBQ-FUPPJEDESA-N |
| XLogP | 4.02 |
| TPSA | 70.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |