C26H29F2N5O3 — CID 172637168
2-but-2-ynyl-7-[(2S,5R)-4-[1-(2,2-difluoro-1,3-benzodioxol-5-yl)ethyl]-2,5-dimethylpiperazin-1-yl]-4-methylpyrazolo[4,3-b]pyridin-5-one (PubChem CID 172637168) has the molecular formula C26H29F2N5O3 and a molecular weight of 497.55 g/mol. Its IUPAC name is 2-but-2-ynyl-7-[(2S,5R)-4-[1-(2,2-difluoro-1,3-benzodioxol-5-yl)ethyl]-2,5-dimethylpiperazin-1-yl]-4-methylpyrazolo[4,3-b]pyridin-5-one.
| Compound Name | 2-but-2-ynyl-7-[(2S,5R)-4-[1-(2,2-difluoro-1,3-benzodioxol-5-yl)ethyl]-2,5-dimethylpiperazin-1-yl]-4-methylpyrazolo[4,3-b]pyridin-5-one |
|---|---|
| PubChem CID | 172637168 |
| Molecular Formula | C26H29F2N5O3 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | 2-but-2-ynyl-7-[(2S,5R)-4-[1-(2,2-difluoro-1,3-benzodioxol-5-yl)ethyl]-2,5-dimethylpiperazin-1-yl]-4-methylpyrazolo[4,3-b]pyridin-5-one |
| SMILES | CC#CCn1cc2c(n1)c(N1C[C@@H](C)N(C(C)c3ccc4c(c3)OC(F)(F)O4)C[C@@H]1C)cc(=O)n2C |
| InChI | InChI=1S/C26H29F2N5O3/c1-6-7-10-31-15-21-25(29-31)20(12-24(34)30(21)5)33-14-16(2)32(13-17(33)3)18(4)19-8-9-22-23(11-19)36-26(27,28)35-22/h8-9,11-12,15-18H,10,13-14H2,1-5H3/t16-,17+,18?/m1/s1 |
| InChIKey | IJPJKLIHHJLLPY-DVKDBIPTSA-N |
| XLogP | 3.74 |
| TPSA | 64.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|