About 3-[(3-oxo-1,2-dihydroisoindol-5-yl)methyl]-3H-1,6-naphthyridin-2-one
3-[(3-oxo-1,2-dihydroisoindol-5-yl)methyl]-3H-1,6-naphthyridin-2-one (PubChem CID 172637312) has the molecular formula C17H13N3O2
and a molecular weight of 291.31 g/mol. Its IUPAC name is 3-[(3-oxo-1,2-dihydroisoindol-5-yl)methyl]-3H-1,6-naphthyridin-2-one.
Molecular Properties
| Compound Name | 3-[(3-oxo-1,2-dihydroisoindol-5-yl)methyl]-3H-1,6-naphthyridin-2-one |
| PubChem CID | 172637312 |
| Molecular Formula | C17H13N3O2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 3-[(3-oxo-1,2-dihydroisoindol-5-yl)methyl]-3H-1,6-naphthyridin-2-one |
| SMILES | O=C1NCc2ccc(CC3C=c4cnccc4=NC3=O)cc21 |
| InChI | InChI=1S/C17H13N3O2/c21-16-12(7-13-8-18-4-3-15(13)20-16)5-10-1-2-11-9-19-17(22)14(11)6-10/h1-4,6-8,12H,5,9H2,(H,19,22) |
| InChIKey | QRFINYAJXJGYIU-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(3-oxo-1,2-dihydroisoindol-5-yl)methyl]-3H-1,6-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-oxo-1,2-dihydroisoindol-5-yl)methyl]-3H-1,6-naphthyridin-2-one?
The IUPAC name of 3-[(3-oxo-1,2-dihydroisoindol-5-yl)methyl]-3H-1,6-naphthyridin-2-one (CID 172637312) is 3-[(3-oxo-1,2-dihydroisoindol-5-yl)methyl]-3H-1,6-naphthyridin-2-one.
What is the SMILES notation for 3-[(3-oxo-1,2-dihydroisoindol-5-yl)methyl]-3H-1,6-naphthyridin-2-one?
The canonical SMILES for 3-[(3-oxo-1,2-dihydroisoindol-5-yl)methyl]-3H-1,6-naphthyridin-2-one is O=C1NCc2ccc(CC3C=c4cnccc4=NC3=O)cc21.
What is the InChIKey of 3-[(3-oxo-1,2-dihydroisoindol-5-yl)methyl]-3H-1,6-naphthyridin-2-one?
The InChIKey is QRFINYAJXJGYIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N3O2/c21-16-12(7-13-8-18-4-3-15(13)20-16)5-10-1-2-11-9-19-17(22)14(11)6-10/h1-4,6-8,12H,5,9H2,(H,19,22).
What are the key properties of 3-[(3-oxo-1,2-dihydroisoindol-5-yl)methyl]-3H-1,6-naphthyridin-2-one?
3-[(3-oxo-1,2-dihydroisoindol-5-yl)methyl]-3H-1,6-naphthyridin-2-one has a molecular weight of 291.31 g/mol, XLogP of 0.12, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-oxo-1,2-dihydroisoindol-5-yl)methyl]-3H-1,6-naphthyridin-2-one is sourced from PubChem (CID 172637312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).