C33H43N5O2 — CID 172637382
N-[4-[(2R,3S,4R)-1-acetyl-2-ethyl-3-methyl-4-(4-pentyltriazol-1-yl)-3,4-dihydro-2H-quinolin-6-yl]phenyl]hex-5-enamide (PubChem CID 172637382) has the molecular formula C33H43N5O2 and a molecular weight of 541.74 g/mol. Its IUPAC name is N-[4-[(2R,3S,4R)-1-acetyl-2-ethyl-3-methyl-4-(4-pentyltriazol-1-yl)-3,4-dihydro-2H-quinolin-6-yl]phenyl]hex-5-enamide.
| Compound Name | N-[4-[(2R,3S,4R)-1-acetyl-2-ethyl-3-methyl-4-(4-pentyltriazol-1-yl)-3,4-dihydro-2H-quinolin-6-yl]phenyl]hex-5-enamide |
|---|---|
| PubChem CID | 172637382 |
| Molecular Formula | C33H43N5O2 |
| Molecular Weight | 541.74 g/mol |
| Exact Mass | 541.34 |
| IUPAC Name | N-[4-[(2R,3S,4R)-1-acetyl-2-ethyl-3-methyl-4-(4-pentyltriazol-1-yl)-3,4-dihydro-2H-quinolin-6-yl]phenyl]hex-5-enamide |
| SMILES | C=CCCCC(=O)Nc1ccc(-c2ccc3c(c2)[C@H](n2cc(CCCCC)nn2)[C@@H](C)[C@@H](CC)N3C(C)=O)cc1 |
| InChI | InChI=1S/C33H43N5O2/c1-6-9-11-13-28-22-37(36-35-28)33-23(4)30(8-3)38(24(5)39)31-20-17-26(21-29(31)33)25-15-18-27(19-16-25)34-32(40)14-12-10-7-2/h7,15-23,30,33H,2,6,8-14H2,1,3-5H3,(H,34,40)/t23-,30+,33+/m0/s1 |
| InChIKey | AFRMUALLYYQJRO-AGBIFLDSSA-N |
| XLogP | 7.34 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.74 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|