C10H3N5S2 — CID 172638266
2-[1-cyano-2,2-bis(sulfanyl)ethenyl]prop-1-ene-1,1,3,3-tetracarbonitrile (PubChem CID 172638266) has the molecular formula C10H3N5S2 and a molecular weight of 257.30 g/mol. Its IUPAC name is 2-[1-cyano-2,2-bis(sulfanyl)ethenyl]prop-1-ene-1,1,3,3-tetracarbonitrile.
| Compound Name | 2-[1-cyano-2,2-bis(sulfanyl)ethenyl]prop-1-ene-1,1,3,3-tetracarbonitrile |
|---|---|
| PubChem CID | 172638266 |
| Molecular Formula | C10H3N5S2 |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 256.98 |
| IUPAC Name | 2-[1-cyano-2,2-bis(sulfanyl)ethenyl]prop-1-ene-1,1,3,3-tetracarbonitrile |
| SMILES | N#CC(C#N)=C(C(C#N)=C(S)S)C(C#N)C#N |
| InChI | InChI=1S/C10H3N5S2/c11-1-6(2-12)9(7(3-13)4-14)8(5-15)10(16)17/h6,16-17H |
| InChIKey | UBBRYUQEHILWKW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|