About disodium;3,4,5-trioxocyclopentene-1,2-diolate
disodium;3,4,5-trioxocyclopentene-1,2-diolate (PubChem CID 172638477) has the molecular formula C5Na2O5
and a molecular weight of 186.03 g/mol. Its IUPAC name is disodium;3,4,5-trioxocyclopentene-1,2-diolate.
Molecular Properties
| Compound Name | disodium;3,4,5-trioxocyclopentene-1,2-diolate |
| PubChem CID | 172638477 |
| Molecular Formula | C5Na2O5 |
| Molecular Weight | 186.03 g/mol |
| Exact Mass | 185.95 |
| IUPAC Name | disodium;3,4,5-trioxocyclopentene-1,2-diolate |
| SMILES | O=c1c([O-])c([O-])c(=O)c1=O.[Na+].[Na+] |
| InChI | InChI=1S/C5H2O5.2Na/c6-1-2(7)4(9)5(10)3(1)8;;/h6-7H;;/q;2*+1/p-2 |
| InChIKey | OQXLFPHHAAAVKQ-UHFFFAOYSA-L |
| XLogP | -9.20 |
| TPSA | 97.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.03 |
| LogP ≤ 5 | -9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze disodium;3,4,5-trioxocyclopentene-1,2-diolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;3,4,5-trioxocyclopentene-1,2-diolate?
The IUPAC name of disodium;3,4,5-trioxocyclopentene-1,2-diolate (CID 172638477) is disodium;3,4,5-trioxocyclopentene-1,2-diolate.
What is the SMILES notation for disodium;3,4,5-trioxocyclopentene-1,2-diolate?
The canonical SMILES for disodium;3,4,5-trioxocyclopentene-1,2-diolate is O=c1c([O-])c([O-])c(=O)c1=O.[Na+].[Na+].
What is the InChIKey of disodium;3,4,5-trioxocyclopentene-1,2-diolate?
The InChIKey is OQXLFPHHAAAVKQ-UHFFFAOYSA-L. The full InChI is InChI=1S/C5H2O5.2Na/c6-1-2(7)4(9)5(10)3(1)8;;/h6-7H;;/q;2*+1/p-2.
What are the key properties of disodium;3,4,5-trioxocyclopentene-1,2-diolate?
disodium;3,4,5-trioxocyclopentene-1,2-diolate has a molecular weight of 186.03 g/mol, XLogP of -9.20, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;3,4,5-trioxocyclopentene-1,2-diolate is sourced from PubChem (CID 172638477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).