C23H28N6O4S — CID 172638823
1-cyclopentyl-3-[(5,7-diethyl-6-oxo-1,2,4a,7a-tetrahydroimidazo[4,5-e][1,2,4]triazin-3-yl)sulfanyl]-2-oxoquinoline-4-carboxylic acid (PubChem CID 172638823) has the molecular formula C23H28N6O4S and a molecular weight of 484.58 g/mol. Its IUPAC name is 1-cyclopentyl-3-[(5,7-diethyl-6-oxo-1,2,4a,7a-tetrahydroimidazo[4,5-e][1,2,4]triazin-3-yl)sulfanyl]-2-oxoquinoline-4-carboxylic acid.
| Compound Name | 1-cyclopentyl-3-[(5,7-diethyl-6-oxo-1,2,4a,7a-tetrahydroimidazo[4,5-e][1,2,4]triazin-3-yl)sulfanyl]-2-oxoquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 172638823 |
| Molecular Formula | C23H28N6O4S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 1-cyclopentyl-3-[(5,7-diethyl-6-oxo-1,2,4a,7a-tetrahydroimidazo[4,5-e][1,2,4]triazin-3-yl)sulfanyl]-2-oxoquinoline-4-carboxylic acid |
| SMILES | CCN1C(=O)N(CC)C2NNC(Sc3c(C(=O)O)c4ccccc4n(C4CCCC4)c3=O)=NC21 |
| InChI | InChI=1S/C23H28N6O4S/c1-3-27-18-19(28(4-2)23(27)33)25-26-22(24-18)34-17-16(21(31)32)14-11-7-8-12-15(14)29(20(17)30)13-9-5-6-10-13/h7-8,11-13,18-19,25H,3-6,9-10H2,1-2H3,(H,24,26)(H,31,32) |
| InChIKey | SCNSRGIRUDMTJF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 119.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |