About N-cyclopropyl-1,4-dimethyl-5-[[6-(trifluoromethyl)-3-pyridinyl]methyl]pyrazole-3-carboxamide
N-cyclopropyl-1,4-dimethyl-5-[[6-(trifluoromethyl)-3-pyridinyl]methyl]pyrazole-3-carboxamide (PubChem CID 172639006) has the molecular formula C16H17F3N4O
and a molecular weight of 338.33 g/mol. Its IUPAC name is N-cyclopropyl-1,4-dimethyl-5-[[6-(trifluoromethyl)-3-pyridinyl]methyl]pyrazole-3-carboxamide.
Molecular Properties
| Compound Name | N-cyclopropyl-1,4-dimethyl-5-[[6-(trifluoromethyl)-3-pyridinyl]methyl]pyrazole-3-carboxamide |
| PubChem CID | 172639006 |
| Molecular Formula | C16H17F3N4O |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | N-cyclopropyl-1,4-dimethyl-5-[[6-(trifluoromethyl)-3-pyridinyl]methyl]pyrazole-3-carboxamide |
| SMILES | Cc1c(C(=O)NC2CC2)nn(C)c1Cc1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C16H17F3N4O/c1-9-12(7-10-3-6-13(20-8-10)16(17,18)19)23(2)22-14(9)15(24)21-11-4-5-11/h3,6,8,11H,4-5,7H2,1-2H3,(H,21,24) |
| InChIKey | AMRWUDNUTGWQIA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclopropyl-1,4-dimethyl-5-[[6-(trifluoromethyl)-3-pyridinyl]methyl]pyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-1,4-dimethyl-5-[[6-(trifluoromethyl)-3-pyridinyl]methyl]pyrazole-3-carboxamide?
The IUPAC name of N-cyclopropyl-1,4-dimethyl-5-[[6-(trifluoromethyl)-3-pyridinyl]methyl]pyrazole-3-carboxamide (CID 172639006) is N-cyclopropyl-1,4-dimethyl-5-[[6-(trifluoromethyl)-3-pyridinyl]methyl]pyrazole-3-carboxamide.
What is the SMILES notation for N-cyclopropyl-1,4-dimethyl-5-[[6-(trifluoromethyl)-3-pyridinyl]methyl]pyrazole-3-carboxamide?
The canonical SMILES for N-cyclopropyl-1,4-dimethyl-5-[[6-(trifluoromethyl)-3-pyridinyl]methyl]pyrazole-3-carboxamide is Cc1c(C(=O)NC2CC2)nn(C)c1Cc1ccc(C(F)(F)F)nc1.
What is the InChIKey of N-cyclopropyl-1,4-dimethyl-5-[[6-(trifluoromethyl)-3-pyridinyl]methyl]pyrazole-3-carboxamide?
The InChIKey is AMRWUDNUTGWQIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17F3N4O/c1-9-12(7-10-3-6-13(20-8-10)16(17,18)19)23(2)22-14(9)15(24)21-11-4-5-11/h3,6,8,11H,4-5,7H2,1-2H3,(H,21,24).
What are the key properties of N-cyclopropyl-1,4-dimethyl-5-[[6-(trifluoromethyl)-3-pyridinyl]methyl]pyrazole-3-carboxamide?
N-cyclopropyl-1,4-dimethyl-5-[[6-(trifluoromethyl)-3-pyridinyl]methyl]pyrazole-3-carboxamide has a molecular weight of 338.33 g/mol, XLogP of 2.63, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-1,4-dimethyl-5-[[6-(trifluoromethyl)-3-pyridinyl]methyl]pyrazole-3-carboxamide is sourced from PubChem (CID 172639006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).