About 5-bromo-6,7-dichloro-1H-indole
5-bromo-6,7-dichloro-1H-indole (PubChem CID 172639291) has the molecular formula C8H4BrCl2N
and a molecular weight of 264.94 g/mol. Its IUPAC name is 5-bromo-6,7-dichloro-1H-indole.
Molecular Properties
| Compound Name | 5-bromo-6,7-dichloro-1H-indole |
| PubChem CID | 172639291 |
| Molecular Formula | C8H4BrCl2N |
| Molecular Weight | 264.94 g/mol |
| Exact Mass | 262.89 |
| IUPAC Name | 5-bromo-6,7-dichloro-1H-indole |
| SMILES | Clc1c(Br)cc2cc[nH]c2c1Cl |
| InChI | InChI=1S/C8H4BrCl2N/c9-5-3-4-1-2-12-8(4)7(11)6(5)10/h1-3,12H |
| InChIKey | HHFWMXAOWBWMAV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.94 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-6,7-dichloro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-6,7-dichloro-1H-indole?
The IUPAC name of 5-bromo-6,7-dichloro-1H-indole (CID 172639291) is 5-bromo-6,7-dichloro-1H-indole.
What is the SMILES notation for 5-bromo-6,7-dichloro-1H-indole?
The canonical SMILES for 5-bromo-6,7-dichloro-1H-indole is Clc1c(Br)cc2cc[nH]c2c1Cl.
What is the InChIKey of 5-bromo-6,7-dichloro-1H-indole?
The InChIKey is HHFWMXAOWBWMAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4BrCl2N/c9-5-3-4-1-2-12-8(4)7(11)6(5)10/h1-3,12H.
What are the key properties of 5-bromo-6,7-dichloro-1H-indole?
5-bromo-6,7-dichloro-1H-indole has a molecular weight of 264.94 g/mol, XLogP of 4.24, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-6,7-dichloro-1H-indole is sourced from PubChem (CID 172639291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).