C20H29F3N4O9 — CID 172639310
3-[3-[[(5S)-5-amino-6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-oxohexyl]amino]-3-oxopropoxy]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 172639310) has the molecular formula C20H29F3N4O9 and a molecular weight of 526.47 g/mol. Its IUPAC name is 3-[3-[[(5S)-5-amino-6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-oxohexyl]amino]-3-oxopropoxy]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[3-[[(5S)-5-amino-6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-oxohexyl]amino]-3-oxopropoxy]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 172639310 |
| Molecular Formula | C20H29F3N4O9 |
| Molecular Weight | 526.47 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | 3-[3-[[(5S)-5-amino-6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-oxohexyl]amino]-3-oxopropoxy]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | N[C@@H](CCCCNC(=O)CCOCCC(=O)O)C(=O)NCCN1C(=O)C=CC1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H28N4O7.C2HF3O2/c19-13(18(28)21-9-10-22-15(24)4-5-16(22)25)3-1-2-8-20-14(23)6-11-29-12-7-17(26)27;3-2(4,5)1(6)7/h4-5,13H,1-3,6-12,19H2,(H,20,23)(H,21,28)(H,26,27);(H,6,7)/t13-;/m0./s1 |
| InChIKey | JNSHNLGCSGBVDQ-ZOWNYOTGSA-N |
| XLogP | -0.84 |
| TPSA | 205.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.47 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|