C20H22N8O2 — CID 172640049
N-[5-[4-[(1R,3S)-3-aminocyclopentyl]oxy-2-methoxy-6-methyl-3-pyridinyl]-1H-pyrazol-3-yl]-5-isocyanopyrazin-2-amine (PubChem CID 172640049) has the molecular formula C20H22N8O2 and a molecular weight of 406.45 g/mol. Its IUPAC name is N-[5-[4-[(1R,3S)-3-aminocyclopentyl]oxy-2-methoxy-6-methyl-3-pyridinyl]-1H-pyrazol-3-yl]-5-isocyanopyrazin-2-amine.
| Compound Name | N-[5-[4-[(1R,3S)-3-aminocyclopentyl]oxy-2-methoxy-6-methyl-3-pyridinyl]-1H-pyrazol-3-yl]-5-isocyanopyrazin-2-amine |
|---|---|
| PubChem CID | 172640049 |
| Molecular Formula | C20H22N8O2 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | N-[5-[4-[(1R,3S)-3-aminocyclopentyl]oxy-2-methoxy-6-methyl-3-pyridinyl]-1H-pyrazol-3-yl]-5-isocyanopyrazin-2-amine |
| SMILES | [C-]#[N+]c1cnc(Nc2cc(-c3c(O[C@@H]4CC[C@H](N)C4)cc(C)nc3OC)[nH]n2)cn1 |
| InChI | InChI=1S/C20H22N8O2/c1-11-6-15(30-13-5-4-12(21)7-13)19(20(25-11)29-3)14-8-16(28-27-14)26-18-10-23-17(22-2)9-24-18/h6,8-10,12-13H,4-5,7,21H2,1,3H3,(H2,24,26,27,28)/t12-,13+/m0/s1 |
| InChIKey | KLNJWVVARJTIKE-QWHCGFSZSA-N |
| XLogP | 3.13 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|