About ethyl (Z)-3-[2-(2,2-dimethylpropyl)cyclopropyl]-2-fluoroprop-2-enoate
ethyl (Z)-3-[2-(2,2-dimethylpropyl)cyclopropyl]-2-fluoroprop-2-enoate (PubChem CID 172640151) has the molecular formula C13H21FO2
and a molecular weight of 228.31 g/mol. Its IUPAC name is ethyl (Z)-3-[2-(2,2-dimethylpropyl)cyclopropyl]-2-fluoroprop-2-enoate.
Molecular Properties
| Compound Name | ethyl (Z)-3-[2-(2,2-dimethylpropyl)cyclopropyl]-2-fluoroprop-2-enoate |
| PubChem CID | 172640151 |
| Molecular Formula | C13H21FO2 |
| Molecular Weight | 228.31 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | ethyl (Z)-3-[2-(2,2-dimethylpropyl)cyclopropyl]-2-fluoroprop-2-enoate |
| SMILES | CCOC(=O)/C(F)=C/C1CC1CC(C)(C)C |
| InChI | InChI=1S/C13H21FO2/c1-5-16-12(15)11(14)7-9-6-10(9)8-13(2,3)4/h7,9-10H,5-6,8H2,1-4H3/b11-7- |
| InChIKey | PZMGRWJBKXDGPC-XFFZJAGNSA-N |
| XLogP | 3.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.31 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (Z)-3-[2-(2,2-dimethylpropyl)cyclopropyl]-2-fluoroprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (Z)-3-[2-(2,2-dimethylpropyl)cyclopropyl]-2-fluoroprop-2-enoate?
The IUPAC name of ethyl (Z)-3-[2-(2,2-dimethylpropyl)cyclopropyl]-2-fluoroprop-2-enoate (CID 172640151) is ethyl (Z)-3-[2-(2,2-dimethylpropyl)cyclopropyl]-2-fluoroprop-2-enoate.
What is the SMILES notation for ethyl (Z)-3-[2-(2,2-dimethylpropyl)cyclopropyl]-2-fluoroprop-2-enoate?
The canonical SMILES for ethyl (Z)-3-[2-(2,2-dimethylpropyl)cyclopropyl]-2-fluoroprop-2-enoate is CCOC(=O)/C(F)=C/C1CC1CC(C)(C)C.
What is the InChIKey of ethyl (Z)-3-[2-(2,2-dimethylpropyl)cyclopropyl]-2-fluoroprop-2-enoate?
The InChIKey is PZMGRWJBKXDGPC-XFFZJAGNSA-N. The full InChI is InChI=1S/C13H21FO2/c1-5-16-12(15)11(14)7-9-6-10(9)8-13(2,3)4/h7,9-10H,5-6,8H2,1-4H3/b11-7-.
What are the key properties of ethyl (Z)-3-[2-(2,2-dimethylpropyl)cyclopropyl]-2-fluoroprop-2-enoate?
ethyl (Z)-3-[2-(2,2-dimethylpropyl)cyclopropyl]-2-fluoroprop-2-enoate has a molecular weight of 228.31 g/mol, XLogP of 3.48, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (Z)-3-[2-(2,2-dimethylpropyl)cyclopropyl]-2-fluoroprop-2-enoate is sourced from PubChem (CID 172640151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).