C16H15N3OS — CID 172640352
N-[4-(1H-indazol-5-yl)phenyl]-3-sulfanylpropanamide (PubChem CID 172640352) has the molecular formula C16H15N3OS and a molecular weight of 297.38 g/mol. Its IUPAC name is N-[4-(1H-indazol-5-yl)phenyl]-3-sulfanylpropanamide.
| Compound Name | N-[4-(1H-indazol-5-yl)phenyl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 172640352 |
| Molecular Formula | C16H15N3OS |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | N-[4-(1H-indazol-5-yl)phenyl]-3-sulfanylpropanamide |
| SMILES | O=C(CCS)Nc1ccc(-c2ccc3[nH]ncc3c2)cc1 |
| InChI | InChI=1S/C16H15N3OS/c20-16(7-8-21)18-14-4-1-11(2-5-14)12-3-6-15-13(9-12)10-17-19-15/h1-6,9-10,21H,7-8H2,(H,17,19)(H,18,20) |
| InChIKey | ZZGDMQGXRAEYOD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|