C11H15F3N2O7 — CID 172640432
(4S)-4-(4-aminobutanoylamino)-5-oxo-5-(2,2,2-trifluoroacetyl)peroxypentanoic acid (PubChem CID 172640432) has the molecular formula C11H15F3N2O7 and a molecular weight of 344.24 g/mol. Its IUPAC name is (4S)-4-(4-aminobutanoylamino)-5-oxo-5-(2,2,2-trifluoroacetyl)peroxypentanoic acid.
| Compound Name | (4S)-4-(4-aminobutanoylamino)-5-oxo-5-(2,2,2-trifluoroacetyl)peroxypentanoic acid |
|---|---|
| PubChem CID | 172640432 |
| Molecular Formula | C11H15F3N2O7 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | (4S)-4-(4-aminobutanoylamino)-5-oxo-5-(2,2,2-trifluoroacetyl)peroxypentanoic acid |
| SMILES | NCCCC(=O)N[C@@H](CCC(=O)O)C(=O)OOC(=O)C(F)(F)F |
| InChI | InChI=1S/C11H15F3N2O7/c12-11(13,14)10(21)23-22-9(20)6(3-4-8(18)19)16-7(17)2-1-5-15/h6H,1-5,15H2,(H,16,17)(H,18,19)/t6-/m0/s1 |
| InChIKey | SJIDSZLXJDFFRS-LURJTMIESA-N |
| XLogP | -0.36 |
| TPSA | 145.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|