C26H35NO6 — CID 172640746
(2S,9S,13E)-2-cyclohexyl-18,21-dimethoxy-11,16-dioxa-4-azatricyclo[15.2.2.04,9]henicosa-1(19),13,17,20-tetraene-3,10-dione (PubChem CID 172640746) has the molecular formula C26H35NO6 and a molecular weight of 457.57 g/mol. Its IUPAC name is (2S,9S,13E)-2-cyclohexyl-18,21-dimethoxy-11,16-dioxa-4-azatricyclo[15.2.2.04,9]henicosa-1(19),13,17,20-tetraene-3,10-dione.
| Compound Name | (2S,9S,13E)-2-cyclohexyl-18,21-dimethoxy-11,16-dioxa-4-azatricyclo[15.2.2.04,9]henicosa-1(19),13,17,20-tetraene-3,10-dione |
|---|---|
| PubChem CID | 172640746 |
| Molecular Formula | C26H35NO6 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | (2S,9S,13E)-2-cyclohexyl-18,21-dimethoxy-11,16-dioxa-4-azatricyclo[15.2.2.04,9]henicosa-1(19),13,17,20-tetraene-3,10-dione |
| SMILES | COc1cc2cc(OC)c1OC/C=C/COC(=O)[C@@H]1CCCCN1C(=O)[C@H]2C1CCCCC1 |
| InChI | InChI=1S/C26H35NO6/c1-30-21-16-19-17-22(31-2)24(21)32-14-8-9-15-33-26(29)20-12-6-7-13-27(20)25(28)23(19)18-10-4-3-5-11-18/h8-9,16-18,20,23H,3-7,10-15H2,1-2H3/b9-8+/t20-,23-/m0/s1 |
| InChIKey | DSNQSCQMELPHCS-WWQISKJESA-N |
| XLogP | 4.24 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|